![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1. The Requiem.mp3 | 2018-02-26 12:19 | 1.9M | |
| 2. The Radiance.mp3 | 2018-02-26 12:19 | 934K | |
| 3. Burning In The Skies.mp3 | 2018-02-26 12:19 | 3.9M | |
| 4. Empty Spaces.mp3 | 2018-02-26 12:19 | 317K | |
| 5. When They Come For Me.mp3 | 2018-02-26 12:19 | 4.5M | |
| 6. Robot Boy.mp3 | 2018-02-26 12:19 | 4.1M | |
| 7. Jornada Del Muerto.mp3 | 2018-02-26 12:19 | 1.5M | |
| 8. Waiting For The End.mp3 | 2018-02-26 12:19 | 3.6M | |
| 9. Blackout.mp3 | 2018-02-26 12:19 | 4.3M | |
| 10. Wretches And Kings.mp3 | 2018-02-26 12:19 | 3.9M | |
| 11. Wisdom, Justice, And Love.mp3 | 2018-02-26 12:19 | 1.5M | |
| 12. Iridescent.mp3 | 2018-02-26 12:19 | 4.6M | |
| 13. Fallout.mp3 | 2018-02-26 12:19 | 1.3M | |
| 14. The Catalyst.mp3 | 2018-02-26 12:19 | 5.2M | |
| 15. The Messenger.mp3 | 2018-02-26 12:19 | 2.8M | |
| Linkin Park A Thousand Suns cover 2010.jpg | 2018-02-26 12:19 | 30K | |
